C17H22FNO2 — CID 43313075
(E)-3-[2-[cyclohexyl(ethyl)amino]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 43313075) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (E)-3-[2-[cyclohexyl(ethyl)amino]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[cyclohexyl(ethyl)amino]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43313075 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E)-3-[2-[cyclohexyl(ethyl)amino]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | CCN(c1ccc(F)cc1/C=C/C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C17H22FNO2/c1-2-19(15-6-4-3-5-7-15)16-10-9-14(18)12-13(16)8-11-17(20)21/h8-12,15H,2-7H2,1H3,(H,20,21)/b11-8+ |
| InChIKey | JWQOIGAZHVWMHP-DHZHZOJOSA-N |
| XLogP | 4.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|