C14H23FN2 — CID 43313954
4-fluoro-2-(methylaminomethyl)-N-propan-2-yl-N-propylaniline (PubChem CID 43313954) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 4-fluoro-2-(methylaminomethyl)-N-propan-2-yl-N-propylaniline.
| Compound Name | 4-fluoro-2-(methylaminomethyl)-N-propan-2-yl-N-propylaniline |
|---|---|
| PubChem CID | 43313954 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4-fluoro-2-(methylaminomethyl)-N-propan-2-yl-N-propylaniline |
| SMILES | CCCN(c1ccc(F)cc1CNC)C(C)C |
| InChI | InChI=1S/C14H23FN2/c1-5-8-17(11(2)3)14-7-6-13(15)9-12(14)10-16-4/h6-7,9,11,16H,5,8,10H2,1-4H3 |
| InChIKey | YGSUAPIMVBKAJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |