C17H29FN2 — CID 63551014
N-butan-2-yl-N-butyl-2-(ethylaminomethyl)-4-fluoroaniline (PubChem CID 63551014) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-2-(ethylaminomethyl)-4-fluoroaniline.
| Compound Name | N-butan-2-yl-N-butyl-2-(ethylaminomethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 63551014 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N-butan-2-yl-N-butyl-2-(ethylaminomethyl)-4-fluoroaniline |
| SMILES | CCCCN(c1ccc(F)cc1CNCC)C(C)CC |
| InChI | InChI=1S/C17H29FN2/c1-5-8-11-20(14(4)6-2)17-10-9-16(18)12-15(17)13-19-7-3/h9-10,12,14,19H,5-8,11,13H2,1-4H3 |
| InChIKey | BOLFHAPUZLEPNP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |