C17H17BrFNO — CID 43314299
N-[[2-(2-bromo-4-methylphenoxy)-5-fluorophenyl]methyl]cyclopropanamine (PubChem CID 43314299) has the molecular formula C17H17BrFNO and a molecular weight of 350.23 g/mol. Its IUPAC name is N-[[2-(2-bromo-4-methylphenoxy)-5-fluorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-bromo-4-methylphenoxy)-5-fluorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43314299 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[[2-(2-bromo-4-methylphenoxy)-5-fluorophenyl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(Oc2ccc(F)cc2CNC2CC2)c(Br)c1 |
| InChI | InChI=1S/C17H17BrFNO/c1-11-2-6-17(15(18)8-11)21-16-7-3-13(19)9-12(16)10-20-14-4-5-14/h2-3,6-9,14,20H,4-5,10H2,1H3 |
| InChIKey | KSEBOPUEKXYTPB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |