C16H18BrN3O — CID 83188048
N-[[2-(2-bromo-4-methylphenoxy)-4-methylpyrimidin-5-yl]methyl]cyclopropanamine (PubChem CID 83188048) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[[2-(2-bromo-4-methylphenoxy)-4-methylpyrimidin-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(2-bromo-4-methylphenoxy)-4-methylpyrimidin-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 83188048 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[[2-(2-bromo-4-methylphenoxy)-4-methylpyrimidin-5-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(Oc2ncc(CNC3CC3)c(C)n2)c(Br)c1 |
| InChI | InChI=1S/C16H18BrN3O/c1-10-3-6-15(14(17)7-10)21-16-19-9-12(11(2)20-16)8-18-13-4-5-13/h3,6-7,9,13,18H,4-5,8H2,1-2H3 |
| InChIKey | FWOSKABPSLJNNF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |