C17H20BrNO2 — CID 62460870
N-[[5-[(2-bromo-4-methylphenoxy)methyl]-3-methylfuran-2-yl]methyl]cyclopropanamine (PubChem CID 62460870) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is N-[[5-[(2-bromo-4-methylphenoxy)methyl]-3-methylfuran-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(2-bromo-4-methylphenoxy)methyl]-3-methylfuran-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62460870 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[[5-[(2-bromo-4-methylphenoxy)methyl]-3-methylfuran-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(OCc2cc(C)c(CNC3CC3)o2)c(Br)c1 |
| InChI | InChI=1S/C17H20BrNO2/c1-11-3-6-16(15(18)7-11)20-10-14-8-12(2)17(21-14)9-19-13-4-5-13/h3,6-8,13,19H,4-5,9-10H2,1-2H3 |
| InChIKey | WXDUYTBHYDBIIK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |