C16H22BrNO2 — CID 62460702
N-[[5-[(2-bromo-4-methylphenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine (PubChem CID 62460702) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is N-[[5-[(2-bromo-4-methylphenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(2-bromo-4-methylphenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62460702 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[[5-[(2-bromo-4-methylphenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(OCC2CCC(CNC3CC3)O2)c(Br)c1 |
| InChI | InChI=1S/C16H22BrNO2/c1-11-2-7-16(15(17)8-11)19-10-14-6-5-13(20-14)9-18-12-3-4-12/h2,7-8,12-14,18H,3-6,9-10H2,1H3 |
| InChIKey | PTDJYEXZCZYSNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |