C15H19BrClNO2 — CID 62460153
N-[[5-[(2-bromo-4-chlorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine (PubChem CID 62460153) has the molecular formula C15H19BrClNO2 and a molecular weight of 360.68 g/mol. Its IUPAC name is N-[[5-[(2-bromo-4-chlorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(2-bromo-4-chlorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62460153 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[[5-[(2-bromo-4-chlorophenoxy)methyl]oxolan-2-yl]methyl]cyclopropanamine |
| SMILES | Clc1ccc(OCC2CCC(CNC3CC3)O2)c(Br)c1 |
| InChI | InChI=1S/C15H19BrClNO2/c16-14-7-10(17)1-6-15(14)19-9-13-5-4-12(20-13)8-18-11-2-3-11/h1,6-7,11-13,18H,2-5,8-9H2 |
| InChIKey | RWDCXVALDSAHIU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |