C19H22N2 — CID 43315117
1-(9H-fluoren-2-yl)-N-methylpiperidin-4-amine (PubChem CID 43315117) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(9H-fluoren-2-yl)-N-methylpiperidin-4-amine.
| Compound Name | 1-(9H-fluoren-2-yl)-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 43315117 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(9H-fluoren-2-yl)-N-methylpiperidin-4-amine |
| SMILES | CNC1CCN(c2ccc3c(c2)Cc2ccccc2-3)CC1 |
| InChI | InChI=1S/C19H22N2/c1-20-16-8-10-21(11-9-16)17-6-7-19-15(13-17)12-14-4-2-3-5-18(14)19/h2-7,13,16,20H,8-12H2,1H3 |
| InChIKey | JYIFQFBVCDHLFP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |