C15H20O3 — CID 43321437
5-methoxy-1-(4-propylphenyl)pentane-1,3-dione (PubChem CID 43321437) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-methoxy-1-(4-propylphenyl)pentane-1,3-dione.
| Compound Name | 5-methoxy-1-(4-propylphenyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 43321437 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-methoxy-1-(4-propylphenyl)pentane-1,3-dione |
| SMILES | CCCc1ccc(C(=O)CC(=O)CCOC)cc1 |
| InChI | InChI=1S/C15H20O3/c1-3-4-12-5-7-13(8-6-12)15(17)11-14(16)9-10-18-2/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | PDUYCRHEQZQFOS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|