3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid

C15H13Cl2NO2 — CID 43321836

IUPAC3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1cccc(C(=O)O)c1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C15H13Cl2NO2/c1-9(10-5-6-13(16)14(17)8-10)18-12-4-2-3-11(7-12)15(19)20/h2-9,18H,1H3,(H,19,20)
InChIKeyRWTTVAVVZZZBKL-UHFFFAOYSA-N
MW310.18 g/mol
LogP4.86
Rot. Bonds4

About 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid

3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid (PubChem CID 43321836) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid
PubChem CID43321836
Molecular FormulaC15H13Cl2NO2
Molecular Weight310.18 g/mol
Exact Mass309.03
IUPAC Name3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1cccc(C(=O)O)c1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C15H13Cl2NO2/c1-9(10-5-6-13(16)14(17)8-10)18-12-4-2-3-11(7-12)15(19)20/h2-9,18H,1H3,(H,19,20)
InChIKeyRWTTVAVVZZZBKL-UHFFFAOYSA-N
XLogP4.86
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.18
LogP ≤ 54.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid?
The IUPAC name of 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid (CID 43321836) is 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid.
What is the SMILES notation for 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid?
The canonical SMILES for 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid is CC(Nc1cccc(C(=O)O)c1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid?
The InChIKey is RWTTVAVVZZZBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO2/c1-9(10-5-6-13(16)14(17)8-10)18-12-4-2-3-11(7-12)15(19)20/h2-9,18H,1H3,(H,19,20).
What are the key properties of 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid?
3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid has a molecular weight of 310.18 g/mol, XLogP of 4.86, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid is sourced from PubChem (CID 43321836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).