C15H13Cl2NO2 — CID 43321836
3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid (PubChem CID 43321836) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid.
| Compound Name | 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 43321836 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)ethylamino]benzoic acid |
| SMILES | CC(Nc1cccc(C(=O)O)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO2/c1-9(10-5-6-13(16)14(17)8-10)18-12-4-2-3-11(7-12)15(19)20/h2-9,18H,1H3,(H,19,20) |
| InChIKey | RWTTVAVVZZZBKL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |