C13H9ClFNO4S — CID 43323199
5-chloro-2-fluoro-3-(pyridin-4-ylmethylsulfonyl)benzoic acid (PubChem CID 43323199) has the molecular formula C13H9ClFNO4S and a molecular weight of 329.74 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(pyridin-4-ylmethylsulfonyl)benzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-(pyridin-4-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43323199 |
| Molecular Formula | C13H9ClFNO4S |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 5-chloro-2-fluoro-3-(pyridin-4-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)Cc2ccncc2)c1F |
| InChI | InChI=1S/C13H9ClFNO4S/c14-9-5-10(13(17)18)12(15)11(6-9)21(19,20)7-8-1-3-16-4-2-8/h1-6H,7H2,(H,17,18) |
| InChIKey | DOHPLHKPNBHVOB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |