C16H20N2O3 — CID 43324230
1-tert-butyl-3-(2,4-dimethoxyphenyl)pyrazole-4-carbaldehyde (PubChem CID 43324230) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,4-dimethoxyphenyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-tert-butyl-3-(2,4-dimethoxyphenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 43324230 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-tert-butyl-3-(2,4-dimethoxyphenyl)pyrazole-4-carbaldehyde |
| SMILES | COc1ccc(-c2nn(C(C)(C)C)cc2C=O)c(OC)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,3)18-9-11(10-19)15(17-18)13-7-6-12(20-4)8-14(13)21-5/h6-10H,1-5H3 |
| InChIKey | DZOYSQZZAIQLJM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|