3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid

C16H20N2O2 — CID 43324448

IUPAC3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid
SMILESCc1ccc(C)c(-n2cc(C(=O)O)c(C(C)(C)C)n2)c1
InChIInChI=1S/C16H20N2O2/c1-10-6-7-11(2)13(8-10)18-9-12(15(19)20)14(17-18)16(3,4)5/h6-9H,1-5H3,(H,19,20)
InChIKeyAXPXRFIBHSBBHH-UHFFFAOYSA-N
MW272.35 g/mol
LogP3.48
Rot. Bonds2

About 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid

3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid (PubChem CID 43324448) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid
PubChem CID43324448
Molecular FormulaC16H20N2O2
Molecular Weight272.35 g/mol
Exact Mass272.15
IUPAC Name3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid
SMILESCc1ccc(C)c(-n2cc(C(=O)O)c(C(C)(C)C)n2)c1
InChIInChI=1S/C16H20N2O2/c1-10-6-7-11(2)13(8-10)18-9-12(15(19)20)14(17-18)16(3,4)5/h6-9H,1-5H3,(H,19,20)
InChIKeyAXPXRFIBHSBBHH-UHFFFAOYSA-N
XLogP3.48
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.35
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid?
The IUPAC name of 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid (CID 43324448) is 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid is Cc1ccc(C)c(-n2cc(C(=O)O)c(C(C)(C)C)n2)c1.
What is the InChIKey of 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid?
The InChIKey is AXPXRFIBHSBBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-10-6-7-11(2)13(8-10)18-9-12(15(19)20)14(17-18)16(3,4)5/h6-9H,1-5H3,(H,19,20).
What are the key properties of 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid?
3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid has a molecular weight of 272.35 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-(2,5-dimethylphenyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 43324448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).