C16H20N2O2 — CID 63272591
3-tert-butyl-1-[(2-methylphenyl)methyl]pyrazole-4-carboxylic acid (PubChem CID 63272591) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-tert-butyl-1-[(2-methylphenyl)methyl]pyrazole-4-carboxylic acid.
| Compound Name | 3-tert-butyl-1-[(2-methylphenyl)methyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 63272591 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-tert-butyl-1-[(2-methylphenyl)methyl]pyrazole-4-carboxylic acid |
| SMILES | Cc1ccccc1Cn1cc(C(=O)O)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H20N2O2/c1-11-7-5-6-8-12(11)9-18-10-13(15(19)20)14(17-18)16(2,3)4/h5-8,10H,9H2,1-4H3,(H,19,20) |
| InChIKey | UDENTZGVIZXJPD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |