C10H13N3O5 — CID 43329670
4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]butanoic acid (PubChem CID 43329670) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]butanoic acid.
| Compound Name | 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43329670 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N3O5/c1-13(4-2-3-8(15)16)9(17)6-5-7(14)12-10(18)11-6/h5H,2-4H2,1H3,(H,15,16)(H2,11,12,14,18) |
| InChIKey | JTEBXTSNMRULHR-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |