C12H5Cl3N2S — CID 43332783
4-chloro-6-(3,5-dichlorophenyl)thieno[3,2-d]pyrimidine (PubChem CID 43332783) has the molecular formula C12H5Cl3N2S and a molecular weight of 315.61 g/mol. Its IUPAC name is 4-chloro-6-(3,5-dichlorophenyl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-chloro-6-(3,5-dichlorophenyl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 43332783 |
| Molecular Formula | C12H5Cl3N2S |
| Molecular Weight | 315.61 g/mol |
| Exact Mass | 313.92 |
| IUPAC Name | 4-chloro-6-(3,5-dichlorophenyl)thieno[3,2-d]pyrimidine |
| SMILES | Clc1cc(Cl)cc(-c2cc3ncnc(Cl)c3s2)c1 |
| InChI | InChI=1S/C12H5Cl3N2S/c13-7-1-6(2-8(14)3-7)10-4-9-11(18-10)12(15)17-5-16-9/h1-5H |
| InChIKey | IZDZWUWAYMWKFI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |