C12H5BrClFN2S — CID 114560090
6-(2-bromo-6-fluorophenyl)-4-chlorothieno[3,2-d]pyrimidine (PubChem CID 114560090) has the molecular formula C12H5BrClFN2S and a molecular weight of 343.61 g/mol. Its IUPAC name is 6-(2-bromo-6-fluorophenyl)-4-chlorothieno[3,2-d]pyrimidine.
| Compound Name | 6-(2-bromo-6-fluorophenyl)-4-chlorothieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 114560090 |
| Molecular Formula | C12H5BrClFN2S |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.90 |
| IUPAC Name | 6-(2-bromo-6-fluorophenyl)-4-chlorothieno[3,2-d]pyrimidine |
| SMILES | Fc1cccc(Br)c1-c1cc2ncnc(Cl)c2s1 |
| InChI | InChI=1S/C12H5BrClFN2S/c13-6-2-1-3-7(15)10(6)9-4-8-11(18-9)12(14)17-5-16-8/h1-5H |
| InChIKey | MHLBMMIDLVRUBI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |