C13H8ClN3O2S — CID 43332810
4-chloro-6-(2-methyl-6-nitrophenyl)thieno[3,2-d]pyrimidine (PubChem CID 43332810) has the molecular formula C13H8ClN3O2S and a molecular weight of 305.75 g/mol. Its IUPAC name is 4-chloro-6-(2-methyl-6-nitrophenyl)thieno[3,2-d]pyrimidine.
| Compound Name | 4-chloro-6-(2-methyl-6-nitrophenyl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 43332810 |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-chloro-6-(2-methyl-6-nitrophenyl)thieno[3,2-d]pyrimidine |
| SMILES | Cc1cccc([N+](=O)[O-])c1-c1cc2ncnc(Cl)c2s1 |
| InChI | InChI=1S/C13H8ClN3O2S/c1-7-3-2-4-9(17(18)19)11(7)10-5-8-12(20-10)13(14)16-6-15-8/h2-6H,1H3 |
| InChIKey | JRXFBKURVAGABQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|