C15H13ClN2O2 — CID 43335617
4-(3-chlorophenyl)-3-(2,5-dimethylfuran-3-yl)-1,2-oxazol-5-amine (PubChem CID 43335617) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-(2,5-dimethylfuran-3-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3-chlorophenyl)-3-(2,5-dimethylfuran-3-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43335617 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-(3-chlorophenyl)-3-(2,5-dimethylfuran-3-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1cc(-c2noc(N)c2-c2cccc(Cl)c2)c(C)o1 |
| InChI | InChI=1S/C15H13ClN2O2/c1-8-6-12(9(2)19-8)14-13(15(17)20-18-14)10-4-3-5-11(16)7-10/h3-7H,17H2,1-2H3 |
| InChIKey | IMVLCHWFAAFBJK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |