C13H8Cl2N2O2 — CID 43335962
4-(2,4-dichlorophenyl)-3-(furan-2-yl)-1,2-oxazol-5-amine (PubChem CID 43335962) has the molecular formula C13H8Cl2N2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-(furan-2-yl)-1,2-oxazol-5-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-3-(furan-2-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43335962 |
| Molecular Formula | C13H8Cl2N2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-(furan-2-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ccco2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl2N2O2/c14-7-3-4-8(9(15)6-7)11-12(17-19-13(11)16)10-2-1-5-18-10/h1-6H,16H2 |
| InChIKey | ZRLNDZZEFKVGOG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |