C17H17FO3 — CID 43337653
(3,4-diethoxyphenyl)-(2-fluorophenyl)methanone (PubChem CID 43337653) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(2-fluorophenyl)methanone.
| Compound Name | (3,4-diethoxyphenyl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 43337653 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3,4-diethoxyphenyl)-(2-fluorophenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2ccccc2F)cc1OCC |
| InChI | InChI=1S/C17H17FO3/c1-3-20-15-10-9-12(11-16(15)21-4-2)17(19)13-7-5-6-8-14(13)18/h5-11H,3-4H2,1-2H3 |
| InChIKey | GQEHUZYHVXPXKY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |