C21H23FO6 — CID 23884909
[2-(2-fluorophenyl)-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 23884909) has the molecular formula C21H23FO6 and a molecular weight of 390.41 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 23884909 |
| Molecular Formula | C21H23FO6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)c2ccccc2F)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H23FO6/c1-4-25-18-11-14(12-19(26-5-2)20(18)27-6-3)21(24)28-13-17(23)15-9-7-8-10-16(15)22/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | BPUQRCQKVPGYJP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |