C15H17ClN2O2 — CID 43343044
1-N-(5-chloro-2,4-dimethoxyphenyl)-2-methylbenzene-1,4-diamine (PubChem CID 43343044) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 1-N-(5-chloro-2,4-dimethoxyphenyl)-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(5-chloro-2,4-dimethoxyphenyl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 43343044 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-N-(5-chloro-2,4-dimethoxyphenyl)-2-methylbenzene-1,4-diamine |
| SMILES | COc1cc(OC)c(Nc2ccc(N)cc2C)cc1Cl |
| InChI | InChI=1S/C15H17ClN2O2/c1-9-6-10(17)4-5-12(9)18-13-7-11(16)14(19-2)8-15(13)20-3/h4-8,18H,17H2,1-3H3 |
| InChIKey | XORDQLUQQVFFPR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|