C19H18N2 — CID 43344281
3-N-benzhydrylbenzene-1,3-diamine (PubChem CID 43344281) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-N-benzhydrylbenzene-1,3-diamine.
| Compound Name | 3-N-benzhydrylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 43344281 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-N-benzhydrylbenzene-1,3-diamine |
| SMILES | Nc1cccc(NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2/c20-17-12-7-13-18(14-17)21-19(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,19,21H,20H2 |
| InChIKey | FQEOJFPNQASCNS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|