C14H12BrFN2OS — CID 43345287
4-[(2-bromophenyl)sulfanylmethyl]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 43345287) has the molecular formula C14H12BrFN2OS and a molecular weight of 355.23 g/mol. Its IUPAC name is 4-[(2-bromophenyl)sulfanylmethyl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(2-bromophenyl)sulfanylmethyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 43345287 |
| Molecular Formula | C14H12BrFN2OS |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4-[(2-bromophenyl)sulfanylmethyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(CSc2ccccc2Br)c(F)c1 |
| InChI | InChI=1S/C14H12BrFN2OS/c15-11-3-1-2-4-13(11)20-8-10-6-5-9(7-12(10)16)14(17)18-19/h1-7,19H,8H2,(H2,17,18) |
| InChIKey | DTYMDDYSAICWKA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|