C12H16BrNOS — CID 43345398
1-(4-bromophenyl)sulfanyl-3-(cyclopropylamino)propan-2-ol (PubChem CID 43345398) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(cyclopropylamino)propan-2-ol.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(cyclopropylamino)propan-2-ol |
|---|---|
| PubChem CID | 43345398 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(cyclopropylamino)propan-2-ol |
| SMILES | OC(CNC1CC1)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H16BrNOS/c13-9-1-5-12(6-2-9)16-8-11(15)7-14-10-3-4-10/h1-2,5-6,10-11,14-15H,3-4,7-8H2 |
| InChIKey | YTMLOYZXRQYPNV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |