C15H21BrOS — CID 66056467
2-(4-bromophenyl)sulfanyl-1-(3-methylcyclohexyl)ethanol (PubChem CID 66056467) has the molecular formula C15H21BrOS and a molecular weight of 329.30 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-1-(3-methylcyclohexyl)ethanol.
| Compound Name | 2-(4-bromophenyl)sulfanyl-1-(3-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 66056467 |
| Molecular Formula | C15H21BrOS |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-1-(3-methylcyclohexyl)ethanol |
| SMILES | CC1CCCC(C(O)CSc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C15H21BrOS/c1-11-3-2-4-12(9-11)15(17)10-18-14-7-5-13(16)6-8-14/h5-8,11-12,15,17H,2-4,9-10H2,1H3 |
| InChIKey | BXMRCJXOLJOBEF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |