C11H9F2N3O4S — CID 43345420
1-[2-(2,4-difluorophenyl)sulfonylethyl]triazole-4-carboxylic acid (PubChem CID 43345420) has the molecular formula C11H9F2N3O4S and a molecular weight of 317.27 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)sulfonylethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2,4-difluorophenyl)sulfonylethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43345420 |
| Molecular Formula | C11H9F2N3O4S |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)sulfonylethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCS(=O)(=O)c2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C11H9F2N3O4S/c12-7-1-2-10(8(13)5-7)21(19,20)4-3-16-6-9(11(17)18)14-15-16/h1-2,5-6H,3-4H2,(H,17,18) |
| InChIKey | VEXZLBGODPQILE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |