About 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid
1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid (PubChem CID 43345413) has the molecular formula C11H9F2N3O2S
and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid |
| PubChem CID | 43345413 |
| Molecular Formula | C11H9F2N3O2S |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCSc2cc(F)ccc2F)nn1 |
| InChI | InChI=1S/C11H9F2N3O2S/c12-7-1-2-8(13)10(5-7)19-4-3-16-6-9(11(17)18)14-15-16/h1-2,5-6H,3-4H2,(H,17,18) |
| InChIKey | FLXPHEPTKKPISP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid (CID 43345413) is 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid is O=C(O)c1cn(CCSc2cc(F)ccc2F)nn1.
What is the InChIKey of 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid?
The InChIKey is FLXPHEPTKKPISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N3O2S/c12-7-1-2-8(13)10(5-7)19-4-3-16-6-9(11(17)18)14-15-16/h1-2,5-6H,3-4H2,(H,17,18).
What are the key properties of 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid?
1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid has a molecular weight of 285.27 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,5-difluorophenyl)sulfanylethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 43345413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).