C15H17NO4 — CID 43345958
3-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 43345958) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | 3-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 43345958 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-methyl-2-(5-methyl-1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | CCC(C)C(C(=O)O)N1C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C15H17NO4/c1-4-9(3)12(15(19)20)16-13(17)10-6-5-8(2)7-11(10)14(16)18/h5-7,9,12H,4H2,1-3H3,(H,19,20) |
| InChIKey | JQQYNCJYWKRFKT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|