C14H11BrF2N2O — CID 43347758
2-[(2-bromo-4,6-difluoroanilino)methyl]benzamide (PubChem CID 43347758) has the molecular formula C14H11BrF2N2O and a molecular weight of 341.16 g/mol. Its IUPAC name is 2-[(2-bromo-4,6-difluoroanilino)methyl]benzamide.
| Compound Name | 2-[(2-bromo-4,6-difluoroanilino)methyl]benzamide |
|---|---|
| PubChem CID | 43347758 |
| Molecular Formula | C14H11BrF2N2O |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-[(2-bromo-4,6-difluoroanilino)methyl]benzamide |
| SMILES | NC(=O)c1ccccc1CNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C14H11BrF2N2O/c15-11-5-9(16)6-12(17)13(11)19-7-8-3-1-2-4-10(8)14(18)20/h1-6,19H,7H2,(H2,18,20) |
| InChIKey | QKLZSRFWGUSCNS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |