C16H17ClO4 — CID 43351526
3-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]furan-2-carboxylic acid (PubChem CID 43351526) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 3-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43351526 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(Cl)c(C(C)C)cc1OCc1ccoc1C(=O)O |
| InChI | InChI=1S/C16H17ClO4/c1-9(2)12-7-14(10(3)6-13(12)17)21-8-11-4-5-20-15(11)16(18)19/h4-7,9H,8H2,1-3H3,(H,18,19) |
| InChIKey | MAFWYWLGYMSRHL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |