C16H17ClO3S — CID 63416095
5-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 63416095) has the molecular formula C16H17ClO3S and a molecular weight of 324.83 g/mol. Its IUPAC name is 5-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63416095 |
| Molecular Formula | C16H17ClO3S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(Cl)c(C(C)C)cc1OCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C16H17ClO3S/c1-9(2)12-7-14(10(3)6-13(12)17)20-8-11-4-5-15(21-11)16(18)19/h4-7,9H,8H2,1-3H3,(H,18,19) |
| InChIKey | AAPAZPCSXJKVTP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |