C13H11FO3S — CID 64853998
5-[(2-fluoro-5-methylphenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 64853998) has the molecular formula C13H11FO3S and a molecular weight of 266.29 g/mol. Its IUPAC name is 5-[(2-fluoro-5-methylphenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(2-fluoro-5-methylphenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 64853998 |
| Molecular Formula | C13H11FO3S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 5-[(2-fluoro-5-methylphenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(F)c(OCc2ccc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C13H11FO3S/c1-8-2-4-10(14)11(6-8)17-7-9-3-5-12(18-9)13(15)16/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | QTDMOOXUNMSCGX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |