C12H8Cl2O3S — CID 63379886
5-[(3,5-dichlorophenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 63379886) has the molecular formula C12H8Cl2O3S and a molecular weight of 303.17 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(3,5-dichlorophenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63379886 |
| Molecular Formula | C12H8Cl2O3S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 5-[(3,5-dichlorophenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C12H8Cl2O3S/c13-7-3-8(14)5-9(4-7)17-6-10-1-2-11(18-10)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | FEHFMXZYOZIIJH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |