C12H8Cl2O4 — CID 55055887
5-[(3,5-dichlorophenoxy)methyl]furan-3-carboxylic acid (PubChem CID 55055887) has the molecular formula C12H8Cl2O4 and a molecular weight of 287.10 g/mol. Its IUPAC name is 5-[(3,5-dichlorophenoxy)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(3,5-dichlorophenoxy)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 55055887 |
| Molecular Formula | C12H8Cl2O4 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 5-[(3,5-dichlorophenoxy)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(COc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C12H8Cl2O4/c13-8-2-9(14)4-10(3-8)18-6-11-1-7(5-17-11)12(15)16/h1-5H,6H2,(H,15,16) |
| InChIKey | AAWXOISUDZCHBY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |