azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid

C13H15NO5 — CID 131666805

IUPACazane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid
SMILESCOc1ccc(OCc2cc(C(=O)O)co2)cc1.N
InChIInChI=1S/C13H12O5.H3N/c1-16-10-2-4-11(5-3-10)18-8-12-6-9(7-17-12)13(14)15;/h2-7H,8H2,1H3,(H,14,15);1H3
InChIKeyWOMCLQSUKDSGIF-UHFFFAOYSA-N
MW265.27 g/mol
LogP2.73
Rot. Bonds5

About azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid

azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid (PubChem CID 131666805) has the molecular formula C13H15NO5 and a molecular weight of 265.27 g/mol. Its IUPAC name is azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid.

Molecular Properties

Compound Nameazane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid
PubChem CID131666805
Molecular FormulaC13H15NO5
Molecular Weight265.27 g/mol
Exact Mass265.10
IUPAC Nameazane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid
SMILESCOc1ccc(OCc2cc(C(=O)O)co2)cc1.N
InChIInChI=1S/C13H12O5.H3N/c1-16-10-2-4-11(5-3-10)18-8-12-6-9(7-17-12)13(14)15;/h2-7H,8H2,1H3,(H,14,15);1H3
InChIKeyWOMCLQSUKDSGIF-UHFFFAOYSA-N
XLogP2.73
TPSA103.90 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.27
LogP ≤ 52.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid?
The IUPAC name of azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid (CID 131666805) is azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid.
What is the SMILES notation for azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid?
The canonical SMILES for azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid is COc1ccc(OCc2cc(C(=O)O)co2)cc1.N.
What is the InChIKey of azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid?
The InChIKey is WOMCLQSUKDSGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5.H3N/c1-16-10-2-4-11(5-3-10)18-8-12-6-9(7-17-12)13(14)15;/h2-7H,8H2,1H3,(H,14,15);1H3.
What are the key properties of azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid?
azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid has a molecular weight of 265.27 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-[(4-methoxyphenoxy)methyl]furan-3-carboxylic acid is sourced from PubChem (CID 131666805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).