C14H14O5 — CID 62268499
5-[(4-ethoxyphenoxy)methyl]furan-3-carboxylic acid (PubChem CID 62268499) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-[(4-ethoxyphenoxy)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(4-ethoxyphenoxy)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 62268499 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-[(4-ethoxyphenoxy)methyl]furan-3-carboxylic acid |
| SMILES | CCOc1ccc(OCc2cc(C(=O)O)co2)cc1 |
| InChI | InChI=1S/C14H14O5/c1-2-17-11-3-5-12(6-4-11)19-9-13-7-10(8-18-13)14(15)16/h3-8H,2,9H2,1H3,(H,15,16) |
| InChIKey | QPFDWXCJOARZKT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |