C14H21N3O4 — CID 43352982
6-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]hexanoic acid (PubChem CID 43352982) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43352982 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]hexanoic acid |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C14H21N3O4/c1-9-11(10(2)17-14(21)16-9)8-12(18)15-7-5-3-4-6-13(19)20/h3-8H2,1-2H3,(H,15,18)(H,19,20)(H,16,17,21) |
| InChIKey | BZLSHZWOUQABBQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|