C10H12N2O3S — CID 43354856
3-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoic acid (PubChem CID 43354856) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 3-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoic acid.
| Compound Name | 3-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 43354856 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 3-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)CSc1ccncc1 |
| InChI | InChI=1S/C10H12N2O3S/c13-9(12-6-3-10(14)15)7-16-8-1-4-11-5-2-8/h1-2,4-5H,3,6-7H2,(H,12,13)(H,14,15) |
| InChIKey | JMITUIQDFQFHMF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |