C12H14N2O5S — CID 60832489
2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanedioic acid (PubChem CID 60832489) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanedioic acid.
| Compound Name | 2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 60832489 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CSc1ccncc1)C(=O)O |
| InChI | InChI=1S/C12H14N2O5S/c15-10(7-20-8-3-5-13-6-4-8)14-9(12(18)19)1-2-11(16)17/h3-6,9H,1-2,7H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | HXJWMQYTKOQQQB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |