C13H18N2O4S — CID 81077244
5-methoxy-2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanoic acid (PubChem CID 81077244) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 5-methoxy-2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanoic acid.
| Compound Name | 5-methoxy-2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 81077244 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-methoxy-2-[(2-pyridin-4-ylsulfanylacetyl)amino]pentanoic acid |
| SMILES | COCCCC(NC(=O)CSc1ccncc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O4S/c1-19-8-2-3-11(13(17)18)15-12(16)9-20-10-4-6-14-7-5-10/h4-7,11H,2-3,8-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OQVQKWJDDJDADW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|