C9H11N3O5 — CID 43354912
3-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoic acid (PubChem CID 43354912) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43354912 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H11N3O5/c13-6(10-2-1-8(15)16)3-5-4-7(14)12-9(17)11-5/h4H,1-3H2,(H,10,13)(H,15,16)(H2,11,12,14,17) |
| InChIKey | RHRRTVCTXQNWAS-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |