C12H17N3O4 — CID 43355150
4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]butanoic acid (PubChem CID 43355150) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43355150 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]butanoic acid |
| SMILES | Cc1nc(=O)[nH]c(C)c1CC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-7-9(8(2)15-12(19)14-7)6-10(16)13-5-3-4-11(17)18/h3-6H2,1-2H3,(H,13,16)(H,17,18)(H,14,15,19) |
| InChIKey | CNESVDZPBMOMIJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|