C9H11N3O4 — CID 43355310
2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid (PubChem CID 43355310) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43355310 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)Cn1cccnc1=O)C(=O)O |
| InChI | InChI=1S/C9H11N3O4/c1-6(8(14)15)11-7(13)5-12-4-2-3-10-9(12)16/h2-4,6H,5H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | AIMGFZGUIGKCEN-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |