C10H13N3O5 — CID 43623505
methyl 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoate (PubChem CID 43623505) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 43623505 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(CO)NC(=O)Cn1cccnc1=O |
| InChI | InChI=1S/C10H13N3O5/c1-18-9(16)7(6-14)12-8(15)5-13-4-2-3-11-10(13)17/h2-4,7,14H,5-6H2,1H3,(H,12,15) |
| InChIKey | YPHTVJLFKXHOKV-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |