C12H15N3O4S — CID 43355679
1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 43355679) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43355679 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CSc1nc(=O)[nH]c(C)c1C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C12H15N3O4S/c1-6-8(9(20-2)14-12(19)13-6)10(16)15-5-3-4-7(15)11(17)18/h7H,3-5H2,1-2H3,(H,17,18)(H,13,14,19) |
| InChIKey | YWCDEOBMEYMQBZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |