C13H17N3O4S — CID 43356082
1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)piperidine-2-carboxylic acid (PubChem CID 43356082) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43356082 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-(6-methyl-4-methylsulfanyl-2-oxo-1H-pyrimidine-5-carbonyl)piperidine-2-carboxylic acid |
| SMILES | CSc1nc(=O)[nH]c(C)c1C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C13H17N3O4S/c1-7-9(10(21-2)15-13(20)14-7)11(17)16-6-4-3-5-8(16)12(18)19/h8H,3-6H2,1-2H3,(H,18,19)(H,14,15,20) |
| InChIKey | APPAUYOGYYCJDC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |