C12H8BrNO4S — CID 43357230
2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid (PubChem CID 43357230) has the molecular formula C12H8BrNO4S and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43357230 |
| Molecular Formula | C12H8BrNO4S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 2-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(Br)o1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C12H8BrNO4S/c13-9-3-1-7(18-9)2-4-10(15)14-11-8(12(16)17)5-6-19-11/h1-6H,(H,14,15)(H,16,17)/b4-2+ |
| InChIKey | KUXFNJPFIKCYFB-DUXPYHPUSA-N |
| XLogP | 3.45 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|